|
|
| | 3-METHYL-4-HYDROXYPYRIDINE Basic information |
| Product Name: | 3-METHYL-4-HYDROXYPYRIDINE | | Synonyms: | 4-Hydroxy-3-picoline;3-METHYL-4-HYDROXYPYRIDINE 96%;3-METHYL-4-HYDROXYPYRIDINE;3-METHYL-4-PYRIDINOL;CHEMPACIFIC 38144;4-Hydroxy-3-methylpyridine;3-METHYL-PYRIDIN-4-OL;3-Methyl-4-hydroxypyridine98% | | CAS: | 22280-02-0 | | MF: | C6H7NO | | MW: | 109.13 | | EINECS: | 640-487-2 | | Product Categories: | Pyridines | | Mol File: | 22280-02-0.mol |  |
| | 3-METHYL-4-HYDROXYPYRIDINE Chemical Properties |
| Melting point | ca 168℃ | | Boiling point | 359.1±22.0 °C(Predicted) | | density | 1.120±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 5.59±0.18(Predicted) | | color | Light Yellow to Dark Yellow | | Water Solubility | Soluble in water (14 g/L) (25°C). | | InChI | InChI=1S/C6H7NO/c1-5-4-7-3-2-6(5)8/h2-4H,1H3,(H,7,8) | | InChIKey | RZUBLMCZJPIOPF-UHFFFAOYSA-N | | SMILES | C1=NC=CC(O)=C1C | | CAS DataBase Reference | 22280-02-0 |
| | 3-METHYL-4-HYDROXYPYRIDINE Usage And Synthesis |
| Uses | 4-Hydroxy-3-methylpyridine, is an building block used in the chemical synthesis of various pharmaceutical and biologically active compounds. It is an intermediate for the synthesis of second generation agonist of the orphan G-protein coupled receptor GPR119, for the treatment of diabetes. |
| | 3-METHYL-4-HYDROXYPYRIDINE Preparation Products And Raw materials |
|