|
|
| | (S)-N-Fmoc-4-Bromophenylalanine Basic information |
| | (S)-N-Fmoc-4-Bromophenylalanine Chemical Properties |
| Melting point | 151.5 °C | | Boiling point | 660.8±55.0 °C(Predicted) | | density | 1.4220 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 3.72±0.10(Predicted) | | form | Solid | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C24H20BrNO4/c25-16-11-9-15(10-12-16)13-22(23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1 | | InChIKey | TVBAVBWXRDHONF-QFIPXVFZSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(Br)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 198561-04-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| Provider | Language |
|
ACROS
| English |
| | (S)-N-Fmoc-4-Bromophenylalanine Usage And Synthesis |
| Chemical Properties | off-white to light yellow crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | (S)-N-Fmoc-4-Bromophenylalanine Preparation Products And Raw materials |
|