|
|
| | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Basic information |
| Product Name: | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate | | Synonyms: | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate;4-(2-Chlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid dimethyl ester;4-(2-Chlorophenyl)-1,4-dihydro-2,6-diMethyl-3,5-pyridinedicarboxylic Acid 3,5-DiMethyl Ester;4-(2-Chlorophenyl)-3,5-di(Methoxycarbonyl)-2,6-diMethyl-1,4-
dihydropyridine;AMlodipine IMpurity G (EP);AMlodipine EP IMpurity G;dimethyl 4-(2-chlorophenyl);Amlodipine Besylate Impurity G | | CAS: | 43067-01-2 | | MF: | C17H18ClNO4 | | MW: | 335.78 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Intermediates;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 43067-01-2.mol |  |
| | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical Properties |
| Melting point | 196-198℃ | | Boiling point | 436.7±45.0 °C(Predicted) | | density | 1.232±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly) | | form | Solid | | pka | 2.79±0.70(Predicted) | | color | Off-White to Pale Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H18ClNO4/c1-9-13(16(20)22-3)15(11-7-5-6-8-12(11)18)14(10(2)19-9)17(21)23-4/h5-8,15,19H,1-4H3 | | InChIKey | REIGLQUFMMOAFU-UHFFFAOYSA-N | | SMILES | O=C(OC)C1=C(C)NC(C)=C(C(OC)=O)C1C2=C(Cl)C=CC=C2 |
| WGK Germany | WGK 3 | | HS Code | 2933399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Usage And Synthesis |
| Uses | Amlodipine Besilate (A633500) impurity. | | Uses | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (Amlodipine EP Impurity G) is an Amlodipine Besilate (A633500) impurity. |
| | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Preparation Products And Raw materials |
|