- Fulvestrant 9-Sulfone
-
- $0.10 / 1KG
-
2019-12-26
- CAS:98008-06-1
- Min. Order: 1KG
- Purity: 95%-99%
- Supply Ability: 1kg; 50kg
|
| | Fulvestrant 9-Sulfone Basic information |
| Product Name: | Fulvestrant 9-Sulfone | | Synonyms: | Fulvestrant 9-Sulfone;(7α,17β)-7-[9-[(4,4,5,5,5-Pentafluoropentyl)sulfonyl]nonyl]estra-1,3,5(10)-triene-3,17-diol;(7R,8R,9S,13S,14S,17S)-13-methyl-7-(9-((4,4,5,5,5-pentafluoropentyl)sulfonyl)nonyl)-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;Fulvestrant EP impurity B;Fulvestrant Impurity 2(Fulvestrant EP Impurity B);Fulvestrant impurity 2/Fulvestrant EP Impurity B/Fulvestrant 9-Sulfone/(7R,8R,9S,13S,14S,17S)-13-Methyl-7-(9-((4,4,5,5,5-pentafluoropentyl) sulfonyl)nonyl)-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;Fulvestrant EP Impurity B (Fulvestrant 9-Sulfone);Fulvestrant-9-Sulfone(Fulvestrant EP Impurity B) | | CAS: | 98008-06-1 | | MF: | C32H47F5O4S | | MW: | 622.77 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Steroids;Sulfur & Selenium Compounds | | Mol File: | 98008-06-1.mol |  |
| | Fulvestrant 9-Sulfone Chemical Properties |
| Melting point | 64-73°C | | Boiling point | 684.7±55.0 °C(Predicted) | | density | 1.205±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 10.27±0.70(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | Major Application | pharmaceutical small molecule | | InChIKey | NQYWBGDKCPOMGL-LBPJHIFHNA-N | | SMILES | c1cc2[C@@H]3CC[C@]4(C)[C@@H](O)CC[C@@H]4[C@@H]3[C@@H](CCCCCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)Cc2cc1O |&1:3,6,8,12,13,14,r| | | EPA Substance Registry System | Fulvestrant sulfone (98008-06-1) |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Chronic 1
Lact.
Repr. 1B |
| | Fulvestrant 9-Sulfone Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A metabolite of Fulvestrant (F862500). | | Definition | ChEBI: Fulvestrant 9-sulfone is a 3-hydroxy steroid. |
| | Fulvestrant 9-Sulfone Preparation Products And Raw materials |
|