| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 6-Trifluoromethyl-3-pyridinesulfonyl Chloride Basic information |
| | 6-Trifluoromethyl-3-pyridinesulfonyl Chloride Chemical Properties |
| Melting point | 42-45℃ | | Fp | >110℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | low-melting solid | | color | White | | InChI | InChI=1S/C6H3ClF3NO2S/c7-14(12,13)4-1-2-5(11-3-4)6(8,9)10/h1-3H | | InChIKey | NSGLNIQAWVNZFB-UHFFFAOYSA-N | | SMILES | C1=NC(C(F)(F)F)=CC=C1S(Cl)(=O)=O | | CAS DataBase Reference | 959996-58-8 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGIII | | WGK Germany | 3 | | HazardClass | 8 | | HazardClass | IRRITANT, CORROSIVE | | HS Code | 2933399990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 6-Trifluoromethyl-3-pyridinesulfonyl Chloride Usage And Synthesis |
| Uses | 6-Trifluoromethyl-3-pyridinesulfonyl Chloride is used for the preparation of N-sulfonamido polycyclic pyrazolyl compounds for treatment of cognitive disorders. | | Uses | 6-Trifluoromethyl-3-pyridinesulfonyl Chloride is a chemical used for the preparation of N-sulfonamido polycyclic pyrazolyl compounds for treatment of cognitive disorders. |
| | 6-Trifluoromethyl-3-pyridinesulfonyl Chloride Preparation Products And Raw materials |
|