|
|
| | 4-(Trifluoromethyl)benzylamine Basic information |
| | 4-(Trifluoromethyl)benzylamine Chemical Properties |
| Melting point | 43 °C | | Boiling point | 79-82 °C (15 mmHg) | | density | 1.229 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.464(lit.) | | Fp | 167 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 8.60±0.10(Predicted) | | form | Liquid | | color | Clear colorless to light yellow | | Specific Gravity | 1.229 | | Sensitive | Air Sensitive | | BRN | 2640698 | | InChI | InChI=1S/C8H8F3N/c9-8(10,11)7-3-1-6(5-12)2-4-7/h1-4H,5,12H2 | | InChIKey | PRDBLLIPPDOICK-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 3300-51-4(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34 | | Safety Statements | 26-36-45-36/37/39 | | RIDADR | 2735 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(Trifluoromethyl)benzylamine Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 4-(Trifluoromethyl)benzylamine has been used in the synthesis of 3-[(2,4-dioxothiazolidin-5-yl)methyl]benzamide derivatives. | | Synthesis | General procedure for the synthesis of 4-(trifluoromethyl)benzylamine from the compound (CAS:16939-49-4): 5.00 g (26.4 mmol) of 4-trifluoromethylbenzaldehyde oxime was dissolved in methanol, followed by the addition of 4.0 g (109.7 mmol) of hydrogen chloride gas and 252 mg of the same catalyst as in Example 1, and the reaction was carried out with continuous stirring for 3 hours. The reaction was carried out at 10 atm hydrogen pressure and room temperature (about 25°C). Upon completion of the reaction, the catalyst was removed and ether was added to the reaction mixture and neutralized with aqueous sodium hydroxide. Analysis of the separated ether layer by gas chromatography confirmed the formation of 4-trifluoromethylbenzylamine in 93.6% yield. | | References | [1] Patent: US6331649, 2001, B1
[2] Patent: WO2009/62949, 2009, A1. Location in patent: Page/Page column 10-11 |
| | 4-(Trifluoromethyl)benzylamine Preparation Products And Raw materials |
|