|
|
| | 6-Fluoro-1H-indole-4-carboxylic acid methyl ester Basic information |
| Product Name: | 6-Fluoro-1H-indole-4-carboxylic acid methyl ester | | Synonyms: | 6-Fluoro indole-4-Methylcarboxylate;6-Fluoro-1H-indole-4-carboxylic acid methyl ester;1H-Indole-4-carboxylic acid, 6-fluoro-, Methyl ester;Methyl 6-fluoro-1H-indole-4-carboxylate;methyl 6-Fluoroindole-4-carboxylate;Rucaparib Intermediate 2;Methyl 6-fluoro-1H-indole-4-carboxvlate | | CAS: | 1082040-43-4 | | MF: | C10H8FNO2 | | MW: | 193.17 | | EINECS: | 607-884-2 | | Product Categories: | 1082040-43-4 | | Mol File: | 1082040-43-4.mol |  |
| | 6-Fluoro-1H-indole-4-carboxylic acid methyl ester Chemical Properties |
| Boiling point | 343.7±27.0 °C(Predicted) | | density | 1.341±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 15.20±0.30(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H8FNO2/c1-14-10(13)8-4-6(11)5-9-7(8)2-3-12-9/h2-5,12H,1H3 | | InChIKey | CKFPLBCOOZCPOR-UHFFFAOYSA-N | | SMILES | N1C2=C(C(C(OC)=O)=CC(F)=C2)C=C1 | | CAS DataBase Reference | 1082040-43-4 |
| | 6-Fluoro-1H-indole-4-carboxylic acid methyl ester Usage And Synthesis |
| Uses | 6-Fluoro-1H-indole-4-carboxylic acid methyl ester (CAS# 1082040-43-4) is an indole derivative and a useful building block, used in the synthesis of PARP Inhibitors, and drug intermediates such as the anti-ovarian cancer drug, rucaparib. |
| | 6-Fluoro-1H-indole-4-carboxylic acid methyl ester Preparation Products And Raw materials |
|