|
|
| | 1-BOC-indole-3-boronic acid, pinacol ester Basic information |
| Product Name: | 1-BOC-indole-3-boronic acid, pinacol ester | | Synonyms: | 1-BOC-indole-3-boronic acid, pinacol ester;N-boc-Indole-3-toronicacidpinacolester;N-BOC-Indole-3-boronic acid;1H-Indole-1-carboxylic acid, 3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-diMethylethyl ester;N-boc-Indole-3-boronic acid pinacol ester;tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate;(1-(TERT-BUTOXYCARBONYL)-1H-INDOL-3-YL)BORONIC ACID PINACOL ESTER;1H-Indole-1-carboxylic acid, 3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-diMethy | | CAS: | 942070-45-3 | | MF: | C19H26BNO4 | | MW: | 343.23 | | EINECS: | | | Product Categories: | | | Mol File: | 942070-45-3.mol |  |
| | 1-BOC-indole-3-boronic acid, pinacol ester Chemical Properties |
| Melting point | 163-165 °C | | Boiling point | 454.6±37.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C19H26BNO4/c1-17(2,3)23-16(22)21-12-14(13-10-8-9-11-15(13)21)20-24-18(4,5)19(6,7)25-20/h8-12H,1-7H3 | | InChIKey | WWMZOMHUEMTTQO-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C2=C(C=CC=C2)C(B2OC(C)(C)C(C)(C)O2)=C1 |
| | 1-BOC-indole-3-boronic acid, pinacol ester Usage And Synthesis |
| | 1-BOC-indole-3-boronic acid, pinacol ester Preparation Products And Raw materials |
|