| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine, min. 97% Basic information |
| | (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine, min. 97% Chemical Properties |
| Melting point | 75-81℃ | | Boiling point | 425.8±28.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 8.73±0.10(Predicted) | | color | white | | Optical Rotation | [α]22/D 59.0°, c = 0.5% in chloroform | | Sensitive | Air Sensitive | | InChI | 1S/C19H18NOP/c20-19(21)17-13-7-8-14-18(17)22(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19,21H,20H2/t19-/m1/s1 | | InChIKey | PUGKRXRRXYUOPD-LJQANCHMSA-N | | SMILES | N[C@H](O)c1ccccc1P(c2ccccc2)c3ccccc3 | | CAS DataBase Reference | 192057-60-6 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine, min. 97% Usage And Synthesis |
| reaction suitability | reagent type: ligand |
| | (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine, min. 97% Preparation Products And Raw materials |
|