Zinc bis(trifluoromethylsulfonyl)imide manufacturers
|
| | Zinc bis(trifluoromethylsulfonyl)imide Basic information | | Reaction |
| Product Name: | Zinc bis(trifluoromethylsulfonyl)imide | | Synonyms: | Zinc(II) Bis(trifluoromethanesulfonyl)imide;Zinc bis(trifluoromethylsulfonyl)imide, min. 97%;Zinc bis(trifluoroMethylsulfonyl)iMide;Zinc di[bis(trifluoromethylsulfonyl)imide];Zn(NTf2)2;Zincbis(trifluoromethylsulfonyl)imide,min.97%;zinc,bis(trifluoromethylsulfonyl)azanide;Bis(trifluoromethanesulfonyl)imide Zinc(II) Salt | | CAS: | 168106-25-0 | | MF: | C4F12N2O8S4Zn | | MW: | 625.65 | | EINECS: | | | Product Categories: | Other Metal;OTf&NTf series | | Mol File: | 168106-25-0.mol |  |
| | Zinc bis(trifluoromethylsulfonyl)imide Chemical Properties |
| Melting point | 143-147℃ | | Fp | >110°(230°F) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | It is soluble in CH2Cl2 and H2O. | | form | Powder | | color | white | | Sensitive | Moisture Sensitive | | Stability: | hygroscopic | | InChI | InChI=1S/2C2F6NO4S2.Zn/c2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q2*-1;+2 | | InChIKey | QEORIOGPVTWFMH-UHFFFAOYSA-N | | SMILES | C(S1([N-]S(=O)(C(F)(F)F)=O[Zn+2]2(O=S(=O)(C(F)(F)F)[N-]S(=O)(C(F)(F)F)=O2)O=1)=O)(F)(F)F | | CAS DataBase Reference | 168106-25-0 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 1759 8/PG II | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2935909099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Zinc bis(trifluoromethylsulfonyl)imide Usage And Synthesis |
| Reaction |
- Useful catalyst for the Diels-Alder reaction.
- Excellent catalyst for the Friedel-Crafts acylations in ionic liquids, or solvent free.
- Active catalyst for the ring-opening of cyclopropanes.
- Used in the asymmetric Friedel-Crafts reaction of pyrroles and acrylates.
| | Uses | Zinc bis(trifluoromethylsulfonyl)imide is used as a Catalyst for Enantioselective Friedel-Crafts alkylation of pyrroles with β-CF3 acrylates, Stereoselective Diels-Alder reaction, Tandem cyclopropane ring-opening / Conia-ene cyclization Aromatic nitration. | | reaction suitability | core: zinc reagent type: catalyst |
| | Zinc bis(trifluoromethylsulfonyl)imide Preparation Products And Raw materials |
|