- Vilazodone Intermediate
-
- $15.00 / 1KG
-
2021-07-02
- CAS:163521-20-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- Vilazodone
-
- $100.00 / 1KG
-
2019-07-06
- CAS:163521-20-8
- Min. Order: 100G
- Purity: 98%
- Supply Ability: 500KG
|
| | Vilazodone Intermediate Basic information |
| Product Name: | Vilazodone Intermediate | | Synonyms: | Ethyl 5-(1-Piperazinyl)benzofuran-2-carboxylate;Vilazodone interMediate;Ethyl 5-(1-Piperazinyl)benzofuran-2-2-carboxylate;Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate;Vilazodone Key interMediates;2-Benzofurancarboxylic acid,5-(1-piperazinyl)-,ethyl ester;5-(1-piperazinyl)benzofuran-2-carboxylic acid ethyl ester;5-(1-Piperazinyl)-2-benzofurancarboxylic Acid Ethyl Ester | | CAS: | 163521-20-8 | | MF: | C15H18N2O3 | | MW: | 274.32 | | EINECS: | 1806241-263-5 | | Product Categories: | | | Mol File: | 163521-20-8.mol |  |
| | Vilazodone Intermediate Chemical Properties |
| Melting point | >141°C (dec.) | | Boiling point | 429.0±35.0 °C(Predicted) | | density | 1?+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO, Methanol | | pka | 8.85±0.10(Predicted) | | form | Solid | | color | Pale Beige | | InChI | InChI=1S/C15H18N2O3/c1-2-19-15(18)14-10-11-9-12(3-4-13(11)20-14)17-7-5-16-6-8-17/h3-4,9-10,16H,2,5-8H2,1H3 | | InChIKey | ZKLDXJIVWKPASZ-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(N3CCNCC3)C=C2C=C1C(OCC)=O |
| | Vilazodone Intermediate Usage And Synthesis |
| Uses | 5-(1-Piperazinyl)-2-benzofurancarboxylic Acid Ethyl Ester is used in the synthesis of benzofuran derivatives for mycobacterium tuberculosis DNA GyrB inhibition. |
| | Vilazodone Intermediate Preparation Products And Raw materials |
|