| Company Name: |
Clickchem Research LLP
|
| Tel: |
+91-8140031133 |
| Email: |
mayur@clickchemresearch.com |
| Products Intro: |
Product Name:TORSEMIDE EP IMPURITY D CAS:160972-33-8 Purity:90 % Above Package:25 mg, 100 mg, 250 mg, 500 mg and 1.0 gm
|
|
| | N-[(n-butylaMino)carbonyl]-4-[(3-Methylphenyl)aMino]-3-pyridinesulfonaMide Basic information |
| Product Name: | N-[(n-butylaMino)carbonyl]-4-[(3-Methylphenyl)aMino]-3-pyridinesulfonaMide | | Synonyms: | N-[(n-butylaMino)carbonyl]-4-[(3-Methylphenyl)aMino]-3-pyridinesulfonaMide;TorseMide Related CoMpound B;Torsemide Related Compound B (75 mg) (N-[(n-butylamino)carbonyl]-4-[(3-methylphenyl)amino]-3-pyridinesulfonamide);TorseMide IMpurity D;N-1-Butyl-1-deMethylethyl TorseMide;Torsemide Related Compound B (50 mg) (N-[(n-butylamino)carbonyl]-4-[(3-methylphenyl)amino]-3-pyridinesulfonamide);Torasemide impurity D (EP);1-butyl-3-[4-(3-methylanilino)pyridin-3-yl]sulfonylurea | | CAS: | 160972-33-8 | | MF: | C17H22N4O3S | | MW: | 362.45 | | EINECS: | | | Product Categories: | | | Mol File: | 160972-33-8.mol | ![N-[(n-butylaMino)carbonyl]-4-[(3-Methylphenyl)aMino]-3-pyridinesulfonaMide Structure](CAS/GIF/160972-33-8.gif) |
| | N-[(n-butylaMino)carbonyl]-4-[(3-Methylphenyl)aMino]-3-pyridinesulfonaMide Chemical Properties |
| Melting point | 132-136°C | | density | 1.260±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 3.39±0.10(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | 1S/C17H22N4O3S/c1-3-4-9-19-17(22)21-25(23,24)16-12-18-10-8-15(16)20-14-7-5-6-13(2)11-14/h5-8,10-12H,3-4,9H2,1-2H3,(H,18,20)(H2,19,21,22) | | InChIKey | YITRQCQYMPXGMU-UHFFFAOYSA-N | | SMILES | CC1=CC(NC2=CC=NC=C2S(=O)(NC(NCCCC)=O)=O)=CC=C1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2935909550 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | N-[(n-butylaMino)carbonyl]-4-[(3-Methylphenyl)aMino]-3-pyridinesulfonaMide Usage And Synthesis |
| Uses | N-1-Butyl-1-demethylethyl Torsemide is an impurity of Torsemide (T548750), a diuretic. |
| | N-[(n-butylaMino)carbonyl]-4-[(3-Methylphenyl)aMino]-3-pyridinesulfonaMide Preparation Products And Raw materials |
|