|
|
| | (E)-3-(4-AMino-3,5-diMethylphenyl)acrylonitrile Hydrochloride Basic information |
| | (E)-3-(4-AMino-3,5-diMethylphenyl)acrylonitrile Hydrochloride Chemical Properties |
| Melting point | 300 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane, Ethyl Acetate, Methanol, Toluene | | form | Solid | | color | Pale Green Crystalline | | InChI | InChI=1S/C11H12N2.ClH/c1-8-6-10(4-3-5-12)7-9(2)11(8)13;/h3-4,6-7H,13H2,1-2H3;1H/b4-3+; | | InChIKey | DHBOHGCHPDMVOD-BJILWQEISA-N | | SMILES | C(/C1C=C(C)C(N)=C(C)C=1)=C\C#N.Cl | | CAS DataBase Reference | 661489-23-2 |
| | (E)-3-(4-AMino-3,5-diMethylphenyl)acrylonitrile Hydrochloride Usage And Synthesis |
| Chemical Properties | Pale Green Crystalline Solid | | Uses | (E)-3-(4-AMino-3,5-diMethylphenyl)acrylonitrile Hydrochloride can be used in the preparation of 5,6-substituted pyrimidines that can possibly inhibit HIV strains resistant to reverse transcriptase inhibitors. |
| | (E)-3-(4-AMino-3,5-diMethylphenyl)acrylonitrile Hydrochloride Preparation Products And Raw materials |
|