| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
Dehydro LoperaMide manufacturers
|
| | Dehydro LoperaMide Basic information |
| Product Name: | Dehydro LoperaMide | | Synonyms: | Dehydro LoperaMide;4-(4-Chlorophenyl)-3,6-dihydro-N,N-diMethyl-α,α-diphenyl-1(2H)-pyridinebutanaMide;LoperaMide EP IMpurity H;4-(4-Chlorophenyl)-3,6-dihydro-N,N-dimethyl-alpha,alpha-diphenyl-1(2H)-pyridinebutanamide;Loperamide impurity 5/Loperamide EP Impurity H/Dehydro Loperamide/4-(4-(4-chlorophenyl)-3,6-dihydropyridin-1(2H)-yl)-N,N-dimethyl-2,2-diphenylbutanamide;Loperamide impurity-H;4-[4-(4-Chlorophenyl)-3,6-dihydropy;1(2H)-Pyridinebutanamide, 4-(4-chlorophenyl)-3,6-dihydro-N,N-dimethyl-α,α-diphenyl- | | CAS: | 61299-42-1 | | MF: | C29H31ClN2O | | MW: | 459.02 | | EINECS: | | | Product Categories: | Amines;Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 61299-42-1.mol |  |
| | Dehydro LoperaMide Chemical Properties |
| Melting point | 127-128°C | | storage temp. | Refrigerator | | solubility | Dichloromethane (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Light Yellow | | Major Application | pharmaceutical small molecule | | InChI | 1S/C29H31ClN2O/c1-31(2)28(33)29(25-9-5-3-6-10-25,26-11-7-4-8-12-26)19-22-32-20-17-24(18-21-32)23-13-15-27(30)16-14-23/h3-17H,18-22H2,1-2H3 | | InChIKey | UUHAGHSPKICYQY-UHFFFAOYSA-N | | SMILES | O=C(N(C)C)C(C1=CC=CC=C1)(C2=CC=CC=C2)CCN3CC=C(C4=CC=C(Cl)C=C4)CC3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Dehydro LoperaMide Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | Loperamide (L469450) impurity. |
| | Dehydro LoperaMide Preparation Products And Raw materials |
|