|
|
| | Iso Ganciclovir Basic information |
| | Iso Ganciclovir Chemical Properties |
| density | 1.81±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.34±0.20(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-2-5(16)1-15/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17) | | InChIKey | YMJRISBBXAOKCD-UHFFFAOYSA-N | | SMILES | [n]1(c2nc(nc(c2nc1)O)N)COCC(O)CO |
| WGK Germany | WGK 3 | | HS Code | 2933599550 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Muta. 1B Repr. 2 |
| | Iso Ganciclovir Usage And Synthesis |
| Uses | Iso Ganciclovir is an impurity of the anti-viral Gangiclovir (G235000) and Valganclovir (V092000) used in enzymatic phosphorylation studies of antiherpetic agents. | | Uses | Iso Ganciclovir (Ganciclovir EP Impurity E) is an impurity of the anti-viral Gangiclovir (G235000) and Valganclovir (V092000) used in enzymatic phosphorylation studies of antiherpetic agents. |
| | Iso Ganciclovir Preparation Products And Raw materials |
|