|
|
| | Morpholine, 2,5-diMethyl-, (2R,5R)- Basic information |
| Product Name: | Morpholine, 2,5-diMethyl-, (2R,5R)- | | Synonyms: | (2R,5R)-2,5-Dimethyl-morpholine HCl;Morpholine, 2,5-diMethyl-, (2R,5R)-;(2R,5R)-2,5-Dimethylmorpholine;(2R,5R)-2,5-Dimethylmorpholine HCl ee | | CAS: | 1130061-44-7 | | MF: | C6H13NO | | MW: | 115.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1130061-44-7.mol |  |
| | Morpholine, 2,5-diMethyl-, (2R,5R)- Chemical Properties |
| Boiling point | 151℃ | | density | 0.862 | | Fp | 50℃ | | storage temp. | Store at 0-8 °C | | pka | 9.07±0.60(Predicted) | | Appearance | colorless liquid | | InChI | InChI=1S/C6H13NO/c1-5-4-8-6(2)3-7-5/h5-7H,3-4H2,1-2H3/t5-,6-/m1/s1 | | InChIKey | RPSYMAMREDJAES-PHDIDXHHSA-N | | SMILES | N1[C@H](C)CO[C@H](C)C1 |
| | Morpholine, 2,5-diMethyl-, (2R,5R)- Usage And Synthesis |
| | Morpholine, 2,5-diMethyl-, (2R,5R)- Preparation Products And Raw materials |
|