| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(3-Bromophenyl)pyrrolidine, HCl Basic information |
| | 1-(3-Bromophenyl)pyrrolidine, HCl Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | solid | | InChI | 1S/C10H12BrN.ClH/c11-9-4-3-5-10(8-9)12-6-1-2-7-12;/h3-5,8H,1-2,6-7H2;1H | | InChIKey | GYJHQYGVTRCCDK-UHFFFAOYSA-N | | SMILES | BrC1=CC=CC(N2CCCC2)=C1.Cl |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-(3-Bromophenyl)pyrrolidine, HCl Usage And Synthesis |
| | 1-(3-Bromophenyl)pyrrolidine, HCl Preparation Products And Raw materials |
|