|
|
| | 5-PHENYL-1,3,4-OXADIAZOL-2-AMINE Basic information |
| Product Name: | 5-PHENYL-1,3,4-OXADIAZOL-2-AMINE | | Synonyms: | 5-PHENYL-1,3,4-OXADIAZOL-2-AMINE;AKOS BBS-00006613;2-AMINO-5-PHENYL-1,3,4-OXADIAZOLE;1,3,4-OXADIAZOL-2-AMINE, 5-PHENYL-;AURORA KA-7809;TIMTEC-BB SBB000136;1,3,4-Oxadiazol-2-amine, 5-phenyl- (9CI);1,3,4-OXADIAZOLE, 2-AMINO-5-PHENYL- | | CAS: | 1612-76-6 | | MF: | C8H7N3O | | MW: | 161.16 | | EINECS: | | | Product Categories: | | | Mol File: | 1612-76-6.mol |  |
| | 5-PHENYL-1,3,4-OXADIAZOL-2-AMINE Chemical Properties |
| Melting point | 237-242°C | | Boiling point | 332.3±25.0 °C(Predicted) | | density | 1.276±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | -1.15±0.13(Predicted) | | color | White to Light yellow | | λmax | 277nm(EtOH)(lit.) | | InChI | InChI=1S/C8H7N3O/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11) | | InChIKey | CQSFYCBGVMWPCM-UHFFFAOYSA-N | | SMILES | O1C(C2=CC=CC=C2)=NN=C1N | | CAS DataBase Reference | 1612-76-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | RO0620000 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-PHENYL-1,3,4-OXADIAZOL-2-AMINE Usage And Synthesis |
| Uses | 5-Phenyl-1,3,4-oxadiazol-2-amine can be used as a pH indicator in the acidic range in living cells due to the fluorescence the compound gives off when in an acidic environment. |
| | 5-PHENYL-1,3,4-OXADIAZOL-2-AMINE Preparation Products And Raw materials |
|