| Company Name: |
Accela ChemBio Inc. |
| Tel: |
+1-858-6993322 +86-18019713315 |
| Email: |
info@accelachem.com |
|
| | Methyl 3-Chloro-4-piperazinobenzoate Basic information |
| Product Name: | Methyl 3-Chloro-4-piperazinobenzoate | | Synonyms: | Methyl 3-Chloro-4-piperazinobenzoate;methyl 3-chloro-4-(piperazin-1-yl)benzoate;Benzoic acid, 3-chloro-4-(1-piperazinyl)-, methyl ester;Methyl 3-chloro-4-(1-piperazinyl)benzoate | | CAS: | 234082-16-7 | | MF: | C12H15ClN2O2 | | MW: | 254.71 | | EINECS: | | | Product Categories: | | | Mol File: | 234082-16-7.mol |  |
| | Methyl 3-Chloro-4-piperazinobenzoate Chemical Properties |
| InChI | 1S/C12H15ClN2O2/c1-17-12(16)9-2-3-11(10(13)8-9)15-6-4-14-5-7-15/h2-3,8,14H,4-7H2,1H3 | | InChIKey | YXNWWDUBAHLVBO-UHFFFAOYSA-N | | SMILES | Clc1c(ccc(c1)C(=O)OC)N2CCNCC2 |
| WGK Germany | WGK 3 | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids |
| | Methyl 3-Chloro-4-piperazinobenzoate Usage And Synthesis |
| | Methyl 3-Chloro-4-piperazinobenzoate Preparation Products And Raw materials |
|