| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 4-(pentafluoroethyl)benzoic acid Basic information |
| Product Name: | 4-(pentafluoroethyl)benzoic acid | | Synonyms: | 4-(1,1,2,2,2-Pentafluoroethyl)benzoic acid;p-(Pentafluoroethyl)benzoic acid;4-(1,1,2,2,2-Pentafluoroethyl)benzoic acid 97%;Benzoic acid, 4-(1,1,2,2,2-pentafluoroethyl)-;4-(Perfluoroethyl)benzoic acid | | CAS: | 383-13-1 | | MF: | C9H5F5O2 | | MW: | 240.13 | | EINECS: | | | Product Categories: | | | Mol File: | 383-13-1.mol |  |
| | 4-(pentafluoroethyl)benzoic acid Chemical Properties |
| Melting point | 154-159°C | | Boiling point | 242-243 °C(Press: 748 Torr) | | density | 1.473±0.06 g/cm3(Predicted) | | pka | 3.68±0.10(Predicted) | | form | powder | | InChI | 1S/C9H5F5O2/c10-8(11,9(12,13)14)6-3-1-5(2-4-6)7(15)16/h1-4H,(H,15,16) | | InChIKey | WJKRCWXOKSNIAD-UHFFFAOYSA-N | | SMILES | OC(C1=CC=C(C(F)(F)C(F)(F)F)C=C1)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(pentafluoroethyl)benzoic acid Usage And Synthesis |
| | 4-(pentafluoroethyl)benzoic acid Preparation Products And Raw materials |
|