| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 4-(Tributylstannyl)quinoline Basic information |
| | 4-(Tributylstannyl)quinoline Chemical Properties |
| form | solid | | InChI | 1S/C9H6N.3C4H9.Sn/c1-2-6-9-8(4-1)5-3-7-10-9;3*1-3-4-2;/h1-4,6-7H;3*1,3-4H2,2H3; | | InChIKey | HKHSDOVXXQFZQQ-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccnc2ccccc12 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | 4-(Tributylstannyl)quinoline Usage And Synthesis |
| | 4-(Tributylstannyl)quinoline Preparation Products And Raw materials |
|