| Company Name: |
Nanjing Chemlin Chemical Co., Ltd
|
| Tel: |
025-83697070 13770331960 |
| Email: |
info@chemlin.com.cn |
| Products Intro: |
Product Name:2-Thia-6-azaspiro[3.3]heptane-6-carboxylic acid tert-butyl ester, 2,2-dioxide
CAS:1291487-31-4
Purity:0.98 Package:5KG; 1KG
|
|
| | N-BOC-2-thia-6-azaspiro[3.3]heptane 2,2-dioxide Basic information |
| Product Name: | N-BOC-2-thia-6-azaspiro[3.3]heptane 2,2-dioxide | | Synonyms: | N-BOC-2-thia-6-azaspiro[3.3]heptane 2,2-dioxide;6-Boc-2-Thia-6-aza-spiro[3.3]heptane-2,2-dioxide;6-Boc-2-Thia-6-aza-spiro[...;2-Thia-6-azaspiro[3.3]heptane, 2,2-dioxide-6-carboxylic acid tert-butyl ester;tert-Butyl 2-thia-6-azaspiro[3.3]heptane-6-carboxylate 2,2-dioxide;2-Thia-6-azaspiro[3.3]heptane-6-carboxylic acid tert-butyl ester, 2,2-dioxide;2-Thia-6-azaspiro[3.3]heptane, 2,2-dioxide-6-carboxylic acid tert-butyl ester - T6173;2-Thia-6-azaspiro[3.3]heptane-6-carboxylic acid, 1,1-dimethylethyl ester, 2,2-dioxide | | CAS: | 1291487-31-4 | | MF: | C10H17NO4S | | MW: | 247.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1291487-31-4.mol | ![N-BOC-2-thia-6-azaspiro[3.3]heptane 2,2-dioxide Structure](CAS/GIF/1291487-31-4.gif) |
| | N-BOC-2-thia-6-azaspiro[3.3]heptane 2,2-dioxide Chemical Properties |
| Boiling point | 416.9±45.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -1.10±0.20(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C10H17NO4S/c1-9(2,3)15-8(12)11-4-10(5-11)6-16(13,14)7-10/h4-7H2,1-3H3 | | InChIKey | SZUIVGVHSGBMMY-UHFFFAOYSA-N | | SMILES | O=S1(CC2(CN(C(OC(C)(C)C)=O)C2)C1)=O |
| RIDADR | UN2811 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | N-BOC-2-thia-6-azaspiro[3.3]heptane 2,2-dioxide Usage And Synthesis |
| | N-BOC-2-thia-6-azaspiro[3.3]heptane 2,2-dioxide Preparation Products And Raw materials |
|