|
|
| | 4-[4-Chloro-3-(trifluoromethyl)phenyl]-4-piperidinol Basic information |
| | 4-[4-Chloro-3-(trifluoromethyl)phenyl]-4-piperidinol Chemical Properties |
| Melting point | 138-141 °C(lit.) | | Boiling point | 333.3±42.0 °C(Predicted) | | density | 1.2685 (estimate) | | storage temp. | 2-8°C, protect from light | | solubility | soluble in Methanol | | form | Fine Crystalline Powder | | pka | 13.55±0.20(Predicted) | | color | Beige | | InChI | 1S/C12H13ClF3NO/c13-10-2-1-8(7-9(10)12(14,15)16)11(18)3-5-17-6-4-11/h1-2,7,17-18H,3-6H2 | | InChIKey | RALRVIPTUXSBPO-UHFFFAOYSA-N | | SMILES | OC1(CCNCC1)c2ccc(Cl)c(c2)C(F)(F)F | | CAS DataBase Reference | 21928-50-7(CAS DataBase Reference) |
| | 4-[4-Chloro-3-(trifluoromethyl)phenyl]-4-piperidinol Usage And Synthesis |
| Chemical Properties | BEIGE FINE CRYSTALLINE POWDER | | Uses | 4-(4-Chloro-3-(trifluoromethyl)phenyl)-4-piperidinol may be used to synthesize piperidinols and penfluridol (a neuroleptic agent). |
| | 4-[4-Chloro-3-(trifluoromethyl)phenyl]-4-piperidinol Preparation Products And Raw materials |
|