|
|
| | 4-(4-aMinophenyl)-3-Methyl-4-oxobutanoic acid hydrochloride Basic information |
| Product Name: | 4-(4-aMinophenyl)-3-Methyl-4-oxobutanoic acid hydrochloride | | Synonyms: | 4-(4-aMinophenyl)-3-Methyl-4-oxobutanoic acid hydrochloride;Benzenebutanoic acid, 4-amino-β-methyl-γ-oxo-, hydrochloride (1:1);4-amino-β-methyl-γ-oxo-Benzenebutanoic acid hydrochloride (1:1);Levosimendan Impurity(Hydrochloride）;4-Amino-β-methyl-γ-oxo-benzenebutanoic acid hydrochloride (1:1);4-Amino-beta-methyl-gamma-oxo-benzenebutanoic acid HCl;Left simonium impurity G NO;C11H14ClNO3 | | CAS: | 120757-13-3 | | MF: | C11H14ClNO3 | | MW: | 243.68676 | | EINECS: | | | Product Categories: | | | Mol File: | 120757-13-3.mol |  |
| | 4-(4-aMinophenyl)-3-Methyl-4-oxobutanoic acid hydrochloride Chemical Properties |
| Melting point | 187-188 °C | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C11H13NO3.ClH/c1-7(6-10(13)14)11(15)8-2-4-9(12)5-3-8;/h2-5,7H,6,12H2,1H3,(H,13,14);1H | | InChIKey | TWOMUAFJJQQOJK-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(C)C(C1=CC=C(N)C=C1)=O.[H]Cl |
| | 4-(4-aMinophenyl)-3-Methyl-4-oxobutanoic acid hydrochloride Usage And Synthesis |
| | 4-(4-aMinophenyl)-3-Methyl-4-oxobutanoic acid hydrochloride Preparation Products And Raw materials |
|