- 2,7-Dichlorofluorene
-
- $0.00 / 1G/KG
-
2026-04-25
- CAS:7012-16-0
- Min. Order: 1G/KG
- Purity: 99%
- Supply Ability: 100000000KG
- 2,7-Dichlorofluorene
-
- $0.00 / 1KG
-
2026-04-24
- CAS:7012-16-0
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- 2,7-Dichlorofluorene
-
- $20.00 / 1KG
-
2026-04-23
- CAS:7012-16-0
- Min. Order: 1KG
- Purity: 98%+
- Supply Ability: 300MT/year
|
| | 2,7-Dichlorofluorene Basic information |
| Product Name: | 2,7-Dichlorofluorene | | Synonyms: | 4,4'-Dichloro-2,2'-methylenebiphenyl;2,7-DICHLOROFLUORENE;2,7-DICHLORO-9-FLUORENE;2,7-dichloro-9H-fluorene;NSC 73077;9H-Fluorene, 2,7-dichloro-;2,7-Dichloroflurene;2,7-Dichlorofluorene 98.5% | | CAS: | 7012-16-0 | | MF: | C13H8Cl2 | | MW: | 235.11 | | EINECS: | 676-989-3 | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals;Electronic Chemicals | | Mol File: | 7012-16-0.mol |  |
| | 2,7-Dichlorofluorene Chemical Properties |
| Melting point | 126-128 | | Boiling point | 305.84°C (rough estimate) | | density | 1.1610 (rough estimate) | | refractive index | 1.5610 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Very Slightly, Heated) | | form | crystalline powder | | color | Yellow | | InChI | InChI=1S/C13H8Cl2/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5H2 | | InChIKey | SDPURBHAHVFTGX-UHFFFAOYSA-N | | SMILES | C1C2=C(C=CC(Cl)=C2)C2=C1C=C(Cl)C=C2 | | CAS DataBase Reference | 7012-16-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | Hazard Note | Irritant | | HS Code | 2903998090 |
| Provider | Language |
|
ALFA
| English |
| | 2,7-Dichlorofluorene Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Intermediate in the production of Lumefantrine. | | Synthesis Reference(s) | Synthesis, p. 1181, 1994 DOI: 10.1055/s-1994-25668 |
| | 2,7-Dichlorofluorene Preparation Products And Raw materials |
| Raw materials | 9H-Fluoren-9-ol, 3,6-bis(1,1-dimethylethyl)--->Benzene, 1,1'-methylenebis[4-(1,1-dimethylethyl)-2-iodo--->2,7-Dichloro-9-fluorenone-->3,6-DI-TERT-BUTYLFLUORENE-->2-Bromo-5-chlorobenzaldehyde-->3,6-Di-tert-butylfluorenone, 99%-->4,4'-DI-TERT-BUTYLDIPHENYLMETHANE-->Fluorene-->3-BROMOCHLOROBENZENE | | Preparation Products | 2-Chlorofluorene |
|