| Company Name: |
AF Biochem Co., Ltd. Gold |
| Tel: |
+86-028-60911900 13540204019 |
| Email: |
sales@afbiochem.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
ButanaMide, 2-aMino-3,3-diMethyl-, (2S)- manufacturers
|
| | ButanaMide, 2-aMino-3,3-diMethyl-, (2S)- Basic information |
| | ButanaMide, 2-aMino-3,3-diMethyl-, (2S)- Chemical Properties |
| Boiling point | 242.7±23.0 °C(Predicted) | | density | 0.982±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 16.19±0.50(Predicted) | | Appearance | White to light yellow Solid | | Optical Rotation | 52.269° (C=0.01 g/ml, MeOH) | | InChI | InChI=1S/C6H14N2O/c1-6(2,3)4(7)5(8)9/h4H,7H2,1-3H3,(H2,8,9)/t4-/m1/s1 | | InChIKey | QCVCCWSPZIUXEA-SCSAIBSYSA-N | | SMILES | C(N)(=O)[C@@H](N)C(C)(C)C |
| | ButanaMide, 2-aMino-3,3-diMethyl-, (2S)- Usage And Synthesis |
| | ButanaMide, 2-aMino-3,3-diMethyl-, (2S)- Preparation Products And Raw materials |
|