|
|
| | (S)-5-Chloro-6-Methoxy-α-Methyl-2-naphthaleneacetic Acid Basic information |
| | (S)-5-Chloro-6-Methoxy-α-Methyl-2-naphthaleneacetic Acid Chemical Properties |
| Melting point | 158 °C | | Boiling point | 431.1±30.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 4.73±0.30(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChI | 1S/C14H13ClO3/c1-8(14(16)17)9-3-5-11-10(7-9)4-6-12(18-2)13(11)15/h3-8H,1-2H3,(H,16,17)/t8-/m0/s1 | | InChIKey | RVVAYDHIVLCPBC-QMMMGPOBSA-N | | SMILES | C[C@H](C(O)=O)C1=CC2=CC=C(OC)C(Cl)=C2C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-5-Chloro-6-Methoxy-α-Methyl-2-naphthaleneacetic Acid Usage And Synthesis |
| Uses | (S)-5-Chloro Naproxen is an impurity of (S)-Naproxen (N377520). |
| | (S)-5-Chloro-6-Methoxy-α-Methyl-2-naphthaleneacetic Acid Preparation Products And Raw materials |
|