| Company Name: |
Finetech Industry Limited |
| Tel: |
+86-27-8746-5837 +8619945049750 |
| Email: |
info@finetechnology-ind.com |
| Products Intro: |
Product Name:(1'R,3'S,3S,5R,6R)-5-AMINO-2-AMINOMETHYL-6-(4,6-DIAMINO-2,3-DIHYDROXY-CYCLOHEXYLOXY)-TETRAHYDRO-PYRAN-3,4-DIOL CAS:3947-65-7 Purity:98% Package:1g,10g,25g,100g,500g,1kg
|
|
|
|
|
| Company Name: |
Hangzhou MolCore BioPharmatech Co.,Ltd. |
| Tel: |
+86-057181025280; +8617767106207 |
| Email: |
sales@molcore.com |
| Products Intro: |
Product Name:(2R,3S,4R,5R,6R)-5-Amino-2-(aminomethyl)-6-(((1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl)oxy)tetrahydro-2H-pyran-3,4-diol CAS:3947-65-7 Purity:NLT 98% Package:1G;100G;1KG;50KG Remarks:MC795080
|
|
|
|
|
- Neamine
-
-
2026-06-30
- CAS:3947-65-7
- Purity: 98%
- Supply Ability: 20Tons
|
| | (1'R,3'S,3S,5R,6R)-5-AMINO-2-AMINOMETHYL-6-(4,6-DIAMINO-2,3-DIHYDROXY-CYCLOHEXYLOXY)-TETRAHYDRO-PYRAN-3,4-DIOL Basic information |
| Product Name: | (1'R,3'S,3S,5R,6R)-5-AMINO-2-AMINOMETHYL-6-(4,6-DIAMINO-2,3-DIHYDROXY-CYCLOHEXYLOXY)-TETRAHYDRO-PYRAN-3,4-DIOL | | Synonyms: | 5-AMINO-2-AMINOMETHYL-6-(4,6-DIAMINO-2,3-DIHYDROXY-CYCLOHEXYLOXY)-TETRAHYDRO-PYRAN-3,4-DIOL;U-5214;2-deoxy-4-o-(2,6-diamino-2,6-dideoxy-alpha-d-glucopyranosyl)-d-streptamin;(1'R,3'S,3S,5R,6R)-5-AMINO-2-AMINOMETHYL-6-(4,6-DIAMINO-2,3-DIHYDROXY-CYCLOHEXYLOXY)-TETRAHYDRO-PYRAN-3,4-DIOL;5-amino-2-(aminomethyl)-6-(4,6-diamino-2,3-dihydroxycyclohexyl)oxyoxane-3,4-diol;dekamycinv;neamin;nebramycinx | | CAS: | 3947-65-7 | | MF: | C12H26N4O6 | | MW: | 322.36 | | EINECS: | | | Product Categories: | Intermediates | | Mol File: | 3947-65-7.mol |  |
| | (1'R,3'S,3S,5R,6R)-5-AMINO-2-AMINOMETHYL-6-(4,6-DIAMINO-2,3-DIHYDROXY-CYCLOHEXYLOXY)-TETRAHYDRO-PYRAN-3,4-DIOL Chemical Properties |
| Melting point | 225.5°C (rough estimate) | | Boiling point | 460.98°C (rough estimate) | | alpha | D25+112.8° (c = 1) | | density | 1.1885 (rough estimate) | | refractive index | 1.6120 (estimate) | | storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere | | solubility | Aqueous Acid (Slightly), Methanol (Slightly, Heated), Water (Slightly) | | pka | 13.24±0.70(Predicted) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical small molecule | | InChI | InChI=1/C12H26N4O6/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20/h3-12,17-20H,1-2,13-16H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/s3 | | InChIKey | SYJXFKPQNSDJLI-CLPOQDAFNA-N | | SMILES | [C@@H]1(O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@H](O)[C@@H](CN)O1 |&1:0,2,3,6,8,10,12,14,16,18,r| |
| | (1'R,3'S,3S,5R,6R)-5-AMINO-2-AMINOMETHYL-6-(4,6-DIAMINO-2,3-DIHYDROXY-CYCLOHEXYLOXY)-TETRAHYDRO-PYRAN-3,4-DIOL Usage And Synthesis |
| Uses | Neamine is normally found as a core structure of aminoglycoside antibiotics. It is used in the synthesis of disaccharide neamine derivatives as antibacterial agents. | | Definition | ChEBI: 2-Deoxy-D-streptamine glycosylated at the 4-oxygen with a 6-amino-alpha-D-glucosaminyl group. | | in vivo | Neamine (30-60 mg/kg; subcutaneous injection; daily; for 14 days; male Balb/c nude mice) has anti-tumor effects on AsPC-1 xenograft models. Neamine reduces the expression levels of ANG, Ki-67 and CD31 in tumor xenografts[1]. | Animal Model: | Male Balb/c nude mice (4 weeks old) injected with AsPC-1 cells[1] | | Dosage: | 30 mg/kg, 60 mg/kg | | Administration: | Subcutaneous injection; daily; for 14 days | | Result: | Had anti-tumor effects on AsPC-1 xenograft models.
|
| | IC 50 | Aminoglycoside |
| | (1'R,3'S,3S,5R,6R)-5-AMINO-2-AMINOMETHYL-6-(4,6-DIAMINO-2,3-DIHYDROXY-CYCLOHEXYLOXY)-TETRAHYDRO-PYRAN-3,4-DIOL Preparation Products And Raw materials |
|