| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | PeMetrexed EP IMpurity C Basic information |
| Product Name: | PeMetrexed EP IMpurity C | | Synonyms: | PeMetrexed EP IMpurity C;(S)-Pemetrexed EP Isomer
DISCONTINUED PLEASE SEE P219520;(2S,2''S)-2,2''-[[(5S)-2,2''-Diamino-4,4'',6-trioxo-1,4,4'',6,7,7''-hexahydro-1''H,5H-5,6''-bipyrrolo[2,3-d]pyrimidine-5,5''-diyl]bis(ethylenebenzene-4,1-diylcarbonylimino)]dipentanedioic Acid;(2S,2′S)-2,2′-[[(5S)-2,2′-diamino-4,4′,6-trioxo-1,4,4′,6,7,7′-hexahydro-1′H,5H-5,6′-bipyrrolo[2,3-d]pyrimidine-5,5′-diyl]bis(ethylenebenzene-4,1-diylcarbonylimino)]dipentanedioic acid (Pemetrexed Disodium Impurity） | | CAS: | 1802552-16-4 | | MF: | C40H40N10O13 | | MW: | 868.82 | | EINECS: | | | Product Categories: | | | Mol File: | 1802552-16-4.mol |  |
| | PeMetrexed EP IMpurity C Chemical Properties |
| density | 1.72±0.1 g/cm3(Predicted) | | pka | 3.58±0.10(Predicted) | | InChIKey | MYCCYMLLSPAQLR-NIERSSSYNA-N | | SMILES | C([C@]1(C2NC3NC(N)=NC(=O)C=3C=2CCC2C=CC(C(=O)N[C@H](C(=O)O)CCC(=O)O)=CC=2)C(NC2NC(N)=NC(=O)C1=2)=O)CC1C=CC(C(=O)N[C@H](C(=O)O)CCC(=O)O)=CC=1 |&1:1,22,52,r| |
| | PeMetrexed EP IMpurity C Usage And Synthesis |
| Uses | (S)-Pemetrexed EP Isomer is an isomer of Pemetrexed(A604980). Pemetrexed is used in the treatment of malignant pleural mesothelioma (MPM). |
| | PeMetrexed EP IMpurity C Preparation Products And Raw materials |
|