| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-FMoc-3-piperazinone, 96% Basic information |
| Product Name: | 1-FMoc-3-piperazinone, 96% | | Synonyms: | 1-FMoc-3-piperazinone, 96%;1-FMOC-3-oxopiperazine >98%;1-Piperazinecarboxylic acid, 3-oxo-, 9H-fluoren-9-ylmethyl ester;9H-Fluoren-9-ylmethyl 3-oxo-1-piperazinecarboxylate;(9H-Fluoren-9-yl)methyl 3-oxopiperazine-1-carboxylate;1-FMoc-3-piperazinone | | CAS: | 1119449-40-9 | | MF: | C19H18N2O3 | | MW: | 322.36 | | EINECS: | | | Product Categories: | | | Mol File: | 1119449-40-9.mol |  |
| | 1-FMoc-3-piperazinone, 96% Chemical Properties |
| Melting point | 124°C | | InChI | 1S/C19H18N2O3/c22-18-11-21(10-9-20-18)19(23)24-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17H,9-12H2,(H,20,22) | | InChIKey | YQKHEDWUIMBPKY-UHFFFAOYSA-N | | SMILES | O=C1CN(CCN1)C(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 1119449-40-9 |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-50/53 | | Safety Statements | 26-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2933599590 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-FMoc-3-piperazinone, 96% Usage And Synthesis |
| | 1-FMoc-3-piperazinone, 96% Preparation Products And Raw materials |
|