| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1R,2R)-[N,N′-Bis(2′,3′-dihydroxybenzylidene)]-1,2-diaMinocyclohexane Basic information |
| Product Name: | (1R,2R)-[N,N′-Bis(2′,3′-dihydroxybenzylidene)]-1,2-diaMinocyclohexane | | Synonyms: | (1R,2R)-[N,N′-Bis(2′,3′-dihydroxybenzylidene)]-1,2-diaMinocyclohexane;(1R,2R)-[N,N'-Bis(2',3'-dihydroxybenzylidene)]-1,2-diaminocyclohexane 95%;1,2-Benzenediol, 3,3'-[(1R,2R)-1,2-cyclohexanediylbis(nitrilomethylidyne)]bis-, rel-;(1R,2R)-[N,N′-Bis(2′,3′-dihydroxybenzylidene)]-1,2-diaminocyclohexane | | CAS: | 674285-08-6 | | MF: | C20H22N2O4 | | MW: | 354.4 | | EINECS: | | | Product Categories: | | | Mol File: | 674285-08-6.mol | ![(1R,2R)-[N,N′-Bis(2′,3′-dihydroxybenzylidene)]-1,2-diaMinocyclohexane Structure](CAS/20180808/GIF/674285-08-6.gif) |
| | (1R,2R)-[N,N′-Bis(2′,3′-dihydroxybenzylidene)]-1,2-diaMinocyclohexane Chemical Properties |
| Melting point | 94-116°C | | Boiling point | 603.1±55.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | Fp | >110℃ | | pka | 11.04±0.10(Predicted) | | InChI | 1S/C20H22N2O4/c23-17-9-3-5-13(19(17)25)11-21-15-7-1-2-8-16(15)22-12-14-6-4-10-18(24)20(14)26/h3-6,9-12,15-16,23-26H,1-2,7-8H2/b21-11+,22-12+/t15-,16-/m1/s1 | | InChIKey | CPBBZPRIUALXOD-CFGDMLGUSA-N | | SMILES | Oc1cccc(\C=N\[C@@H]2CCCC[C@H]2\N=C\c3cccc(O)c3O)c1O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1R,2R)-[N,N′-Bis(2′,3′-dihydroxybenzylidene)]-1,2-diaMinocyclohexane Usage And Synthesis |
| | (1R,2R)-[N,N′-Bis(2′,3′-dihydroxybenzylidene)]-1,2-diaMinocyclohexane Preparation Products And Raw materials |
|