|
|
| | 5-Chloro-6-Methoxy-7-azaindole Basic information |
| Product Name: | 5-Chloro-6-Methoxy-7-azaindole | | Synonyms: | 5-Chloro-6-Methoxy-7-azaindole;1H-Pyrrolo[2,3-b]pyridine, 5-chloro-6-methoxy-;5-chloro-6-methoxy-1H-pyrrolo[2,3-b]pyridine;5-chloro-6-methoxy-1H-pyrrolo[2,3-b]pyridine - [C17152] | | CAS: | 1190315-07-1 | | MF: | C8H7ClN2O | | MW: | 182.60698 | | EINECS: | | | Product Categories: | | | Mol File: | 1190315-07-1.mol |  |
| | 5-Chloro-6-Methoxy-7-azaindole Chemical Properties |
| density | 1.393±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 13.19±0.40(Predicted) | | Appearance | Off-White Powder | | InChI | InChI=1S/C8H7ClN2O/c1-12-8-6(9)4-5-2-3-10-7(5)11-8/h2-4H,1H3,(H,10,11) | | InChIKey | LPOXALJAFJSYRZ-UHFFFAOYSA-N | | SMILES | C12NC=CC1=CC(Cl)=C(OC)N=2 |
| | 5-Chloro-6-Methoxy-7-azaindole Usage And Synthesis |
| | 5-Chloro-6-Methoxy-7-azaindole Preparation Products And Raw materials |
|