|
|
| | 2-(Di-t-butylphosphino)-3-methoxy-6-methyl-2',4',6'-tri-i-propyl-1,1'-biphenyl Basic information | | Reaction |
| Product Name: | 2-(Di-t-butylphosphino)-3-methoxy-6-methyl-2',4',6'-tri-i-propyl-1,1'-biphenyl | | Synonyms: | Rockphos;2-Di-tert-butylphosphino-3-Methoxy-6-Methyl-2'-4'-6'-triisopropylbiphenyl, 98% Min;2-(Di-t-butylphosphino)-3-Methoxy-6-Methyl-2'-4'-6'-tri-i-propyl-1,1'-biphenyl, Min. 98% RockPhos;Bis(1,1-dimethylethyl)[3-methoxy-6-methyl-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine;2-Di-tert-butylphosphino-3-Methoxy-6-Methyl-2',4',6'-triisopropyl-1,1'-biphenyl;Di-tert-butyl(2′,4′,6′-triisopropyl-3-methoxy-6-methyl-[1,1′-biphenyl]-2-yl)phosphine;RockPhos 97%;2-Di-tert-butylphosphino-3-Methoxy-6-Methyl-2'-4'-6'-triisopropylbiphenyl | | CAS: | 1262046-34-3 | | MF: | C31H49OP | | MW: | 468.69 | | EINECS: | 805-149-2 | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Buchwald Ligands Series;Buchwald Ligands&Precatalysts | | Mol File: | 1262046-34-3.mol |  |
| | 2-(Di-t-butylphosphino)-3-methoxy-6-methyl-2',4',6'-tri-i-propyl-1,1'-biphenyl Chemical Properties |
| Melting point | 129-130°C | | Boiling point | 526.6±50.0 °C(Predicted) | | storage temp. | 15-25°C | | form | crystal | | color | white | | InChI | InChI=1S/C31H49OP/c1-19(2)23-17-24(20(3)4)28(25(18-23)21(5)6)27-22(7)15-16-26(32-14)29(27)33(30(8,9)10)31(11,12)13/h15-21H,1-14H3 | | InChIKey | CVLLAKCGAFNZHJ-UHFFFAOYSA-N | | SMILES | P(C(C)(C)C)(C(C)(C)C)C1=C(OC)C=CC(C)=C1C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C | | CAS DataBase Reference | 1262046-34-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(Di-t-butylphosphino)-3-methoxy-6-methyl-2',4',6'-tri-i-propyl-1,1'-biphenyl Usage And Synthesis |
| Reaction | Ligand used in the palladium-catalyzed C-O bond forming reactions of secondary and primary alcohols with a range of aryl halides. Heterocyclic halides and, for the first time, electron-rich aryl halides can be coupled with secondary alcohols.
| | Uses | Rockpahos is commonly used as a catalyst in organic reactions along with a palladium compound catalyst. | | Uses | RockPhos is a biphenyl-based phosphine ligand used with Pd(0) catalyst for carbon-carbon and carbon-heteroatom bond formation reactions.
It can also be employed in the:
- 2-fluroethoxylation of bromo-chalcones in the presence of palladium catalyst.
- Conversion of aryl chlorides into aryl methoxides using RockPhos Pd G3 as a catalyst.
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand
reaction type: Cross Couplings |
| | 2-(Di-t-butylphosphino)-3-methoxy-6-methyl-2',4',6'-tri-i-propyl-1,1'-biphenyl Preparation Products And Raw materials |
|