| Company Name: |
Chengdu J&B Technology Co., Ltd. Gold
|
| Tel: |
028-61186694 15608078506 |
| Email: |
609128801@qq.com |
| Products Intro: |
Product Name:Methyl 2-Methylthiazole-4-carboxylate CAS:6436-60-8 Purity:95% Package:5g-10kg
|
| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Methyl 2-Methylthiazole-4-Carboxylate CAS:6436-60-8 Purity:98%+ Package:1g;5g;25g;100g
|
|
| | Methyl 2-Methylthiazole-4-carboxylate Basic information |
| | Methyl 2-Methylthiazole-4-carboxylate Chemical Properties |
| Melting point | 58 °C | | Boiling point | 90 °C(Press: 0.01 Torr) | | density | 1.244±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 0.96±0.10(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C6H7NO2S/c1-4-7-5(3-10-4)6(8)9-2/h3H,1-2H3 | | InChIKey | FZERNAIKPVSQHU-UHFFFAOYSA-N | | SMILES | S1C=C(C(OC)=O)N=C1C |
| | Methyl 2-Methylthiazole-4-carboxylate Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 44, p. 497, 1979 DOI: 10.1021/jo01318a005 |
| | Methyl 2-Methylthiazole-4-carboxylate Preparation Products And Raw materials |
|