| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 1-Boc-3-hydroxy-3-pyrrolidinedicarboxylic acid Methyl ester Basic information |
| Product Name: | 1-Boc-3-hydroxy-3-pyrrolidinedicarboxylic acid Methyl ester | | Synonyms: | 1-tert-Butyl 3-Methyl 3-hydroxypyrrolidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-methyl 3-hydroxypyrrolidine-1,3-dicarboxylate;1,3-Pyrrolidinedicarboxylic acid,3-hydroxy-,1-(1,1-dimethylethyl) 3-methyl ester;Methyl 1-Boc-3-hydroxypyrrolidine-3-carboxylate;1-Boc-3-hydroxy-3-pyrrolidinedicarboxylic acid Methyl ester;1-Boc-3-hydroxypyrrolidine-3-carboxylic acid methyl ester;Methyl 1-Boc-3-hydroxypyrrolidine-3-carboxylate - [M12685] | | CAS: | 942190-61-6 | | MF: | C11H19NO5 | | MW: | 245.27 | | EINECS: | | | Product Categories: | | | Mol File: | 942190-61-6.mol |  |
| | 1-Boc-3-hydroxy-3-pyrrolidinedicarboxylic acid Methyl ester Chemical Properties |
| Melting point | 71 - 73°C | | Boiling point | 314.5±42.0 °C(Predicted) | | density | 1.226±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.57±0.20(Predicted) | | color | Off-White to Pale Brown | | InChI | InChI=1S/C11H19NO5/c1-10(2,3)17-9(14)12-6-5-11(15,7-12)8(13)16-4/h15H,5-7H2,1-4H3 | | InChIKey | ALAIMDFVDAWVMO-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(O)(C(OC)=O)C1 | | CAS DataBase Reference | 942190-61-6 |
| | 1-Boc-3-hydroxy-3-pyrrolidinedicarboxylic acid Methyl ester Usage And Synthesis |
| Uses | 1-tert-Butyl-3-Methyl 3-Hydroxypyrrolidine-1,3-Dicarboxylate can be used as LRRK2 inhibitors to treat diseases in which LRRK2 kinase is involved. | | Synthesis | A mixture of compound 2W (5.3 g, 25 mmol), methanol (50 ml) and dioxane solution of 4N HCl (10 ml) was placed in a sealed tube and the reaction was heated at 70°C overnight. Upon completion of the reaction, the reaction mixture was concentrated, followed by addition of tetrahydrofuran (20 ml), dichloromethane (50 ml), triethylamine (16 ml) and di-tert-butyl dicarbonate (11 g). The mixture was stirred at room temperature overnight and then concentrated. The concentrated residue was diluted with ether (200 ml) and washed with deionized water (100 ml). The organic layer was separated, dried with anhydrous sodium sulfate, filtered and concentrated again. Finally, the residue was purified by silica gel column chromatography using 1:1 (v/v) ethyl acetate/hexanes and 2:1 (v/v) ethyl acetate/hexanes sequentially as eluent to give the target product 3W (4.35 g, 71% yield). | | References | [1] Patent: WO2007/70398, 2007, A1. Location in patent: Page/Page column 440 |
| | 1-Boc-3-hydroxy-3-pyrrolidinedicarboxylic acid Methyl ester Preparation Products And Raw materials |
|