|
|
| | 4,4,5,5-tetraMethyl-2-(1-Methylcyclopropyl)-1,3,2-Dioxaborolane Basic information |
| Product Name: | 4,4,5,5-tetraMethyl-2-(1-Methylcyclopropyl)-1,3,2-Dioxaborolane | | Synonyms: | 4,4,5,5-tetraMethyl-2-(1-Methylcyclopropyl)-1,3,2-Dioxaborolane;1-Methyl-cyclopropylboronic acid pinacle ester;1-Methyl-cyclopropylboronic acid pinacol ester;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(1-methylcyclopropyl)-;4,4,5,5-tetraMethyl-2-(1-Methylcyclopropyl)-1,3,2-Dioxaborolane ISO 9001：2015 REACH;1-methylcyclopropane-1-boronic acidolester | | CAS: | 126689-04-1 | | MF: | C10H19BO2 | | MW: | 182.07 | | EINECS: | | | Product Categories: | | | Mol File: | 126689-04-1.mol |  |
| | 4,4,5,5-tetraMethyl-2-(1-Methylcyclopropyl)-1,3,2-Dioxaborolane Chemical Properties |
| Boiling point | 188.0±9.0 °C(Predicted) | | density | 0.94±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C10H19BO2/c1-8(2)9(3,4)13-11(12-8)10(5)6-7-10/h6-7H2,1-5H3 | | InChIKey | SBMUAPREBINNKY-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1(C)CC1 |
| | 4,4,5,5-tetraMethyl-2-(1-Methylcyclopropyl)-1,3,2-Dioxaborolane Usage And Synthesis |
| Uses | 4,4,5,5-Tetramethyl-2-(1-methylcyclopropyl)-1,3,2-dioxaborolane, is cyclopropylbronate derivative, which can be used in the synthesis of variety of cyclic and acyclic organic compounds. | | Synthesis Reference(s) | Tetrahedron Letters, 30, p. 4815, 1989 DOI: 10.1016/S0040-4039(01)80516-5 |
| | 4,4,5,5-tetraMethyl-2-(1-Methylcyclopropyl)-1,3,2-Dioxaborolane Preparation Products And Raw materials |
|