|
|
| | [1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo- Basic information |
| Product Name: | [1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo- | | Synonyms: | [1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo-;4, 7-dibroMo-[1, 2, 5] thiadiazolo [3, 4-c] pyridine;4,7-dibromopyridal[2,1,3]thiadiazole;4,7-Dibromo[1,2,5]thiadiazolo[3,4-c]pyridine;PT-2Br;4,7-Dibromo[1,2,5]thiadiazolo[3,4-c]pyridine>;4,7-dibromo-[1,2,5]thiazolo[3,4-c]pyridine;4,7-Dibromo-[1,2,5]thiadiazo[3,4-c]pyridine | | CAS: | 333432-27-2 | | MF: | C5HBr2N3S | | MW: | 294.95 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 333432-27-2.mol | ![[1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo- Structure](CAS/GIF/333432-27-2.gif) |
| | [1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo- Chemical Properties |
| Melting point | 146.0 to 150.0 °C | | Boiling point | 347.8±37.0 °C(Predicted) | | density | 2.358±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | powder to crystal | | pka | -5.23±0.50(Predicted) | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C5HBr2N3S/c6-2-1-8-5(7)4-3(2)9-11-10-4/h1H | | InChIKey | LEHZIBSAFRVAJP-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C(Br)C2=NSN=C12 | | CAS DataBase Reference | 333432-27-2 |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | [1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo- Usage And Synthesis |
| Uses | 4,7-Dibromo-[1,2,5]thiadiazolo[3,4-c]pyridine can be used in the synthesis of panchromatic organic for dye sensitized solar cells (DSSCs). | | General Description | 4,7-Dibromo-[1,2,5]thiadiazolo[3,4-c]pyridine is a thiadiazolo[3,4-c]pyridine based material that is used as an electron deficient group for organic electronic applications. | | Synthesis | Under the protection of nitrogen, 2,5-dibromo-3,4-diaminopyridine (2.67 g, 10 mmol) was dissolved in 30 mL of pyridine, cooled down to 0 , sulfoxide chloride (1.79 g, 15 mmol) was added, and naturally raised to room temperature and stirred for 12 hours. The product was extracted with dichloromethane, and after spin-drying the solvent of the organic layer under reduced pressure, the crude product was purified by column chromatography using petroleum ether: ethyl acetate = 4:1 (v/v) as eluent to give a white solid product, 4, 7-dibromo-[1, 2, 5] thiadiazolo[3, 4-C] pyridine. |
| | [1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo- Preparation Products And Raw materials |
|