| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | trans,trans-Farnesyl acetate Basic information |
| Product Name: | trans,trans-Farnesyl acetate | | Synonyms: | (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl acetate;(2E,6E)-Farnesyl acetate;(E)-Farnesyl acetate;[(E,E)-3,7,11-Trimethyl-2,6,10-dodecatriene-1-yl]ester of acetic acid;2-trans-6-trans-Farnesyl acetate;All-trans-Farnesyl acetate;Farnesyl acetate, (E,E)-;trans,trans-Farnesol acetate | | CAS: | 4128-17-0 | | MF: | C17H28O2 | | MW: | 264.4 | | EINECS: | 249-689-1 | | Product Categories: | | | Mol File: | 4128-17-0.mol |  |
| | trans,trans-Farnesyl acetate Chemical Properties |
| Boiling point | 115-125 °C/0.3 mmHg (lit.) | | density | 0.914 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.477 | | Fp | >230 °F | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Odor | at 100.00 %. oily waxy | | Odor Type | oily | | InChI | InChI=1S/C17H28O2/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-19-17(5)18/h8,10,12H,6-7,9,11,13H2,1-5H3/b15-10+,16-12+ | | InChIKey | ZGIGZINMAOQWLX-NCZFFCEISA-N | | SMILES | C(OC(=O)C)/C=C(\C)/CC/C=C(\C)/CC/C=C(/C)\C | | LogP | 6.139 (est) |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | trans,trans-Farnesyl acetate Usage And Synthesis |
| Uses | (2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl Acetate is an intermediate in the synthesis of JHSB3 (J211030). JHSB3 is an acyclic sesquiterpenoid that regulates many aspects of insect physiology. Juvenile Hormone regulate development, reproduction, diapause, and polyphenisms. | | Definition | ChEBI: 3,7,11-Trimethyl-2,6,10-dodecatrienyl acetate is a sesquiterpenoid. | | General Description | trans,trans-Farnesyl acetate is one of the most odor-active or key compounds of Hyuganatsu aroma in Hyuganatsu (Citrus tamurana Hort. ex Tanaka) peel oil. Asymmetric dihydroxylation of trans,trans-farnesyl acetate using the new Sharpless′ ligand has been studied. |
| | trans,trans-Farnesyl acetate Preparation Products And Raw materials |
|