| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(2-Fluoro-3-trifluoromethyl-phenyl)-thiazol-2-ylamine Basic information |
| Product Name: | 4-(2-Fluoro-3-trifluoromethyl-phenyl)-thiazol-2-ylamine | | Synonyms: | 4-[2-Fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine;2-Thiazolamine, 4-[2-fluoro-3-(trifluoromethyl)phenyl]-;4-(2-Fluoro-3-(trifluoromethyl)phenyl)thiazol-2(3h)-imine;4-(2-Fluoro-3-trifluoromethyl-phenyl)-thiazol-2-ylamine | | CAS: | 444143-17-3 | | MF: | C10H6F4N2S | | MW: | 262.23 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-(2-Fluoro-3-trifluoromethyl-phenyl)-thiazol-2-ylamine Chemical Properties |
| Boiling point | 359.1±42.0 °C(Predicted) | | density | 1.478±0.06 g/cm3(Predicted) | | pka | 3.24±0.10(Predicted) | | form | solid | | InChI | 1S/C10H6F4N2S/c11-8-5(7-4-17-9(15)16-7)2-1-3-6(8)10(12,13)14/h1-4H,(H2,15,16) | | InChIKey | QTFIQKQWACKFHA-UHFFFAOYSA-N | | SMILES | FC(F)(C1=CC=CC(C2=CSC(N)=N2)=C1F)F |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1 |
| | 4-(2-Fluoro-3-trifluoromethyl-phenyl)-thiazol-2-ylamine Usage And Synthesis |
| | 4-(2-Fluoro-3-trifluoromethyl-phenyl)-thiazol-2-ylamine Preparation Products And Raw materials |
|