- China MET034
-
- $5.00 / 1KG
-
2021-07-09
- CAS:1071929-08-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000 Kilogram/Kilograms per Month CAS 119736-16-2
|
| | (5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-Methylphenyl)Methanone Basic information |
| Product Name: | (5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-Methylphenyl)Methanone | | Synonyms: | (5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-Methylphenyl)Methanone;2-(5-Iodo-2-Methylbenzoyl)-5-(4-fluorophenyl)thiophene;[5-(4-Fluorophenyl)thiophene-yl](5-iodo-2-Methylphenyl)Methanone;[5-(4-Fluorophenyl)-2-thienyl](5-iodo-2-methylphenyl)-methanone;Methanone,[5-(4-fluorophenyl)-2-thienyl](5-iodo-2-methylphenyl)-;[5-(4-fluorophenyl)-2-thienyl](5-iodo-2-methylphenyl)-methyketone;Methanone,[5-(4-fluorophenyl)-2-thienyl](5-iodo-2-methylphen...;Canagliflozin impurity FQ: What is
Canagliflozin impurity F Q: What is the CAS Number of
Canagliflozin impurity F Q: What is the storage condition of
Canagliflozin impurity F | | CAS: | 1071929-08-2 | | MF: | C18H12FIOS | | MW: | 422.26 | | EINECS: | 924-156-2 | | Product Categories: | | | Mol File: | 1071929-08-2.mol |  |
| | (5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-Methylphenyl)Methanone Chemical Properties |
| Boiling point | 491.4±45.0 °C(Predicted) | | density | 1.594±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C18H12FIOS/c1-11-2-7-14(20)10-15(11)18(21)17-9-8-16(22-17)12-3-5-13(19)6-4-12/h2-10H,1H3 | | InChIKey | UCEUYWYTFYVWBY-UHFFFAOYSA-N | | SMILES | C(C1SC(C2=CC=C(F)C=C2)=CC=1)(C1=CC(I)=CC=C1C)=O |
| | (5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-Methylphenyl)Methanone Usage And Synthesis |
| Uses | [5-(4-Fluorophenyl)-2-thienyl](5-iodo-2-methylphenyl)methanone is a synthetic intermediate for Canagliflozin. |
| | (5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-Methylphenyl)Methanone Preparation Products And Raw materials |
|