- Bis-PEG5-NHS ester
-
-
2025-06-07
- CAS:756526-03-1
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | Bis(NHS)PEG5 Basic information |
| Product Name: | Bis(NHS)PEG5 | | Synonyms: | Bis(NHS)PEG5;Bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16-pentaoxanonadecane-1,19-dioate;BIS-PEG5-NHS;Bis-dPEG(R)5-NHS ester;PEG5 BIS-NHS ESTER;Bis(3-PEG4)propionic acid N-hydroxysuccinimide diester;4,7,10,13,16-Pentaoxanonadecanedioic acid, 1,19-bis(2,5-dioxo-1-pyrrolidinyl) ester;4,7,10,13,16-Pentaoxanonadecanedioic Acid Di(N-succinimidyl) Ester | | CAS: | 756526-03-1 | | MF: | C22H32N2O13 | | MW: | 532.5 | | EINECS: | | | Product Categories: | Homobifunctional PEG | | Mol File: | 756526-03-1.mol |  |
| | Bis(NHS)PEG5 Chemical Properties |
| Boiling point | 632.5±65.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | form | solid or viscous liquid | | color | Colorless to Almost colorless | | Water Solubility | water: soluble | | InChI | 1S/C22H32N2O13/c25-17-1-2-18(26)23(17)36-21(29)5-7-31-9-11-33-13-15-35-16-14-34-12-10-32-8-6-22(30)37-24-19(27)3-4-20(24)28/h1-16H2 | | InChIKey | FTYUGLBWKRXQBD-UHFFFAOYSA-N | | SMILES | O=C(CCOCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O)ON2C(CCC2=O)=O | | CAS DataBase Reference | 756526-03-1 |
| WGK Germany | WGK 3 | | HS Code | 2928.00.5000 | | Storage Class | 10 - Combustible liquids |
| | Bis(NHS)PEG5 Usage And Synthesis |
| Description | Bis-PEG5-NHS ester is a PEG linker containing two NHS ester groups. The hydrophilic PEG spacer increases solubility in aqueous media. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Uses | Bis(NHS)PEG5 is used in targeting M2-like tumor-associated macrophages by using melittin-based pro-apoptotic peptide conjugates with anti-cancer drugs, | | General Description | By contrast to typical PEG reagents that contain heterogeneous mixtures of different PEG chain lengths, this PEG reagent is a homogeneous compound of defined molecular weight and spacer arm length, providing greater precision in optimization and characterization of crosslinking applications. Homobifunctional crosslinkers containing N-hydroxysuccinimide (NHS) esters are often used for low-resolution 3-D studies of protein structure and protein interaction analysis. | | reaction suitability | reagent type: cross-linking reagent
reactivity: amine reactive | | IC 50 | Cleavable Linker; PEGs; Alkyl/ether |
| | Bis(NHS)PEG5 Preparation Products And Raw materials |
|