|
|
| | tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate Basic information |
| Product Name: | tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate | | Synonyms: | Tert-Butyl(1R,2S,5S)-2-azido-5-[(diMethylaMino)carbonyl]cyclohexylcarbaMate oxalic acid;oxalic acid tert-butyl N-[(1R,2S,5S)-2-aMino-5-(diMethylcarbaMoyl)cyclohexyl]carbaMate;(2-Azido-5-diMethylcarbaMoyl-cyclohexyl)-carbaMic acid tert-butyl esteroxalic acid;EthanediaMide iMpurity A/Edoxaban Intermediate II;tert-butyl ((1R,2S,5S)-2-amino-5-(dimethylcarbamoyl)cyclohexyl)carbamate oxalic acid;Edoxaban-1;N-[(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]-Carbamic acid, 1,1-dimethylethyl ester, ethanedioate (1:1);2EthanediaMide iMpurity A | | CAS: | 1210348-34-7 | | MF: | C16H29N3O7 | | MW: | 375.42 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 1210348-34-7.mol | ![tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate Structure](CAS/20150408/GIF/1210348-34-7.gif) |
| | tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White | | InChI | InChI=1/C14H27N3O3.C2H2O4/c1-14(2,3)20-13(19)16-11-8-9(6-7-10(11)15)12(18)17(4)5;3-1(4)2(5)6/h9-11H,6-8,15H2,1-5H3,(H,16,19);(H,3,4)(H,5,6)/t9-,10-,11+;/s3 | | InChIKey | IERZZGXDUZIMSC-FPTARDKGNA-N | | SMILES | C(=O)(O)C(=O)O.N([C@H]1[C@H](CC[C@H](C(=O)N(C)C)C1)N)C(=O)OC(C)(C)C |&1:7,8,11,r| | | CAS DataBase Reference | 1210348-34-7 |
| | tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate Usage And Synthesis |
| Uses | tert-Butyl [(1R,2S,5S)-2-Amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate Oxalate is a starting material and useful building block of various pharmaceuticals. | | Uses | Tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate is also called EthanediaMide iMpurity A. It is a starting material and useful component of various pharmaceuticals. As an organic synthesis intermediate and pharmaceutical intermediate. It could be used in the synthesis and research of the EthanediaMide. | | Synthesis | Tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate is prepared by the reaction of benzyl N-[(1S,2R,4S)-2-{[(tert-butoxy)carbonyl]amino}-4-(dimethylcarbamoyl)cyclohexyl]carbamate and Oxalic Acid. The steps are as follows: Pd-C (230 mg) was added to a solution (35 mL) of benzyl t-butyl{(1S,2R,4S)-4-[(dimethylamino)carbonyl]cyclohexan-1,2-diyl}biscarbamate (2.3 g) in ethanol, and the mixture was stirred in a hydrogen atmosphere for 16 hours. Pd-C was removed by filtration, and the filtrate was concentrated under reduced pressure. Ethyl acetate (20 mL) and anhydrous oxalic acid (493.6 mg) were added to the residue, followed by stirring at room temperature for 17 hours. The formed crystals were recovered by filtration, to thereby yield 1.93 g of the Tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate.
![tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate synthesis tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate synthesis](/NewsImg/2023-12-21/6383876407962529631946858.png) |
| | tert-Butyl [(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate oxalate Preparation Products And Raw materials |
|