|
|
| | Tenofovir Disopropyl Ethyl Diester Basic information |
| Product Name: | Tenofovir Disopropyl Ethyl Diester | | Synonyms: | Tenofovir Disopropyl Ethyl Diester;Tenofovir Impurity 7;Tenofovir Disoproxil Impurity EOC-POCPMPA Fumarate;((((((R)-1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphoryl)bis(oxy))bis(methylene) ethyl isopropyl dicarbonate fumarate;Tenofovir disoproxil Impurity M;Tenofovir impurity M;diisopropyl (((((2-(6-((methoxymethyl)amino)-9H-purin-9-yl)ethoxy)methyl)phosphoryl)bis(oxy))bis(methylene)) dicarbonate;Tenofovir impurity 22/Tenofovir Disopropyl Ethyl Diester Fumarate/Tenofovir Disoproxil Impurity EOC-POCPMPA Fumarate/((((((R)-1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)(((ethoxycarbonyl)oxy)methoxy)phosphoryl)oxy)methyl isopropyl carbonate fumarate | | CAS: | 1422284-17-0 | | MF: | C18H28N5O10P | | MW: | 505.416181 | | EINECS: | | | Product Categories: | | | Mol File: | 1422284-17-0.mol |  |
| | Tenofovir Disopropyl Ethyl Diester Chemical Properties |
| InChIKey | OXROEIBHDASPQM-BFHRRQPWNA-N | | SMILES | n1c(N)c2nc[n](C[C@@H](C)OCP(OCOC(=O)OCC)(=O)OCOC(=O)OC(C)C)c2nc1 |&1:8,r| |
| | Tenofovir Disopropyl Ethyl Diester Usage And Synthesis |
| Uses | Tenofovir Disopropyl Ethyl Diester is an impurity of Tenofovir (T018500), an acyclic phosphonate nucleotide analogue and reverse transcriptase inhibitor. Used as an anti-HIV agent. Antiviral. | | Uses | DEC-POC PMPA is used in the preparation of tenofovoir, an intermediate in the synthesis of tenofovir disoproxil fumarate and related impurities. |
| | Tenofovir Disopropyl Ethyl Diester Preparation Products And Raw materials |
|