|
|
| | 2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetaMide Basic information |
| Product Name: | 2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetaMide | | Synonyms: | 2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetaMide;(ALPHA-(2,6-DICHLOROPHENYL)-4-CHLOROACETANILIDE);Diclofenac impurity 4/Diclofenac EP Impurity F/N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)acetamide;N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)acetamide;Diclofenac Related CoMpound (Alpha-(2,6-Dichlorophenyl)-4-Chloroacetanilide);Diclofenac EP Impurity F;Diclofenac sodium impurity F;N-(4-Chlorophenyl)-2-(2,6-dichlorop | | CAS: | 560075-65-2 | | MF: | C14H10Cl3NO | | MW: | 314.59 | | EINECS: | | | Product Categories: | Amines, Aromatics, Heterocycles, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 560075-65-2.mol |  |
| | 2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetaMide Chemical Properties |
| Melting point | 215-217°C | | Boiling point | 496.8±45.0 °C(Predicted) | | density | 1.436±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 13.00±0.70(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C14H10Cl3NO/c15-9-4-6-10(7-5-9)18-14(19)8-11-12(16)2-1-3-13(11)17/h1-7H,8H2,(H,18,19) | | InChIKey | PZQRCZHTCCSTFP-UHFFFAOYSA-N | | SMILES | C1(CC(NC2=CC=C(Cl)C=C2)=O)=C(Cl)C=CC=C1Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetaMide Usage And Synthesis |
| Uses | 2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetamide is an impurity of Diclofenac (D436450), a known nonsteroidal anti-inflammatory compound and cyclooxygenase (COX) inhibitor. |
| | 2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetaMide Preparation Products And Raw materials |
|