|
|
| | Ethyl 6-oxohexanoate Basic information |
| | Ethyl 6-oxohexanoate Chemical Properties |
| Boiling point | 97-98 °C(Press: 10 Torr) | | density | 0.9994 g/cm3(Temp: 418 °C) | | storage temp. | -20°C, stored under nitrogen | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H14O3/c1-2-11-8(10)6-4-3-5-7-9/h7H,2-6H2,1H3 | | InChIKey | UWNBKRSENSOXKX-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCCCC=O |
| | Ethyl 6-oxohexanoate Usage And Synthesis |
| Uses | Ethyl 6-Oxohexanoate is a reagent used in the synthesis of pharmaceutical agents. Used in the design and synthesis of anti-cancer agents as well as in multi-acting inhibitors against HDAC, FL3 and JAK2. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 52, p. 5400, 1987 DOI: 10.1021/jo00233a018
Tetrahedron Letters, 30, p. 5329, 1989 DOI: 10.1016/S0040-4039(01)93778-5 |
| | Ethyl 6-oxohexanoate Preparation Products And Raw materials |
|