|
|
| | Vortioxetine iMpurity Basic information |
| Product Name: | Vortioxetine iMpurity | | Synonyms: | Vortioxetine Hydrobromide IMP;Vortioxetine Impurity Y;Vortioxetine Impurity 13 HCl;Piperazine, 1-(2-bromophenyl)-, monohydrochloride;1- (2-bromophenyl) piperazine hydrochloride;hydrochloride - [B87560] | | CAS: | 853745-55-8 | | MF: | C10H14BrClN2 | | MW: | 277.59 | | EINECS: | | | Product Categories: | | | Mol File: | 853745-55-8.mol |  |
| | Vortioxetine iMpurity Chemical Properties |
| InChI | InChI=1S/C10H13BrN2.ClH/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H | | InChIKey | BIXLVAQDGFZJLM-UHFFFAOYSA-N | | SMILES | BrC1C=CC=CC=1N1CCNCC1.Cl |
| | Vortioxetine iMpurity Usage And Synthesis |
| | Vortioxetine iMpurity Preparation Products And Raw materials |
|