|
|
| | Copper(I) 3-methylsalicylate Basic information |
| Product Name: | Copper(I) 3-methylsalicylate | | Synonyms: | Copper(I) 3-methylsalicylate;[2-(Hydroxy-κO)-3-methylbenzoato-κO]copper;2-carboxy-6-methylphenolate:copper(1+);SKL064;Copper, [2-(hydroxy-κO)-3-methylbenzoato-κO]-;2-carboxy-6-methylphenolate;3-methylsalicylic acid copper (I);CuMeSal | | CAS: | 326477-70-7 | | MF: | C8H6CuO3 | | MW: | 213.68 | | EINECS: | | | Product Categories: | | | Mol File: | 326477-70-7.mol |  |
| | Copper(I) 3-methylsalicylate Chemical Properties |
| Melting point | 290-292°C | | storage temp. | Store at room temperature, keep dry and cool | | form | solid | | Appearance | Brown to red Solid | | InChI | InChI=1S/C8H8O3.Cu/c1-5-3-2-4-6(7(5)9)8(10)11;/h2-4,9H,1H3,(H,10,11);/q;+2/p-2 | | InChIKey | DRCHROMPYLJMMR-UHFFFAOYSA-L | | SMILES | O=C1[O-][Cu+]OC2=C(C=CC=C12)C |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Copper(I) 3-methylsalicylate Usage And Synthesis |
| Uses | Catalyst for:
- Carbon-carbon bond formation
- Oxidative arylthiation
- Reductive cross-coupling
- Oxidation reactions
- Reductive amination
| | reaction suitability | core: copper
reagent type: catalyst |
| | Copper(I) 3-methylsalicylate Preparation Products And Raw materials |
|