|
|
| | 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one Basic information |
| Product Name: | 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one | | Synonyms: | 1(2H)-Naphthalenone, 3,4-dihydro-5-methoxy-;3,4-dihydro-5-methoxy-1(2h)-naphthalenon;5-Methoxy-3,4-dihydro-1(2H)-naphthalenone;alpha-Tetralone, 5-methoxy-;5-methoxy-1,2,3,4-tetrahydronaphthalen-1-one;5-Methoxy-1-tetralone,97%;5-METHOXY-1-TETRALONE 97%;5-METHOXY-1-TETRALONE TECH 94+% | | CAS: | 33892-75-0 | | MF: | C11H12O2 | | MW: | 176.21 | | EINECS: | 251-723-5 | | Product Categories: | C11 to C12;Carbonyl Compounds;Ketones;Naphthalene derivatives | | Mol File: | 33892-75-0.mol |  |
| | 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one Chemical Properties |
| Melting point | 87-91 °C(lit.) | | Boiling point | 160-162 °C7 mm Hg(lit.) | | density | 1.0431 (rough estimate) | | refractive index | 1.5600 (estimate) | | Fp | 160-162°C/7mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | BRN | 2047383 | | InChI | InChI=1S/C11H12O2/c1-13-11-7-3-4-8-9(11)5-2-6-10(8)12/h3-4,7H,2,5-6H2,1H3 | | InChIKey | BRCPWISABURVIH-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C(OC)=CC=C2)CCC1 | | CAS DataBase Reference | 33892-75-0(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Methoxy-1-tetralone(33892-75-0) |
| | 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one Usage And Synthesis |
| Uses | 5-Methoxy-1-tetralone is used in the preparation of hydroxy ketone. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 24, p. 1759, 1959 DOI: 10.1021/jo01093a037 |
| | 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one Preparation Products And Raw materials |
|