|
|
| | (4R)-N-(tert-Butyloxycarbonyl)-4-(cyanoMethyl)-L-glutaMic Acid 1,5-DiMethyl Ester Basic information |
| Product Name: | (4R)-N-(tert-Butyloxycarbonyl)-4-(cyanoMethyl)-L-glutaMic Acid 1,5-DiMethyl Ester | | Synonyms: | (4R)-N-(tert-Butyloxycarbonyl)-4-(cyanoMethyl)-L-glutaMic Acid 1,5-DiMethyl Ester;Dimethyl (2S,4R)-2-(Boc-amino)-4-(cyanomethyl)pentanedioate;L-Glutamic acid, 4-(cyanomethyl)-N-[(1,1-dimethylethoxy)carbonyl]-, 1,5-dimethyl ester, (4R)-;(2S,4R)-dimethyl 2-((tert-butoxycarbonyl)amino)-4-(cyanomethyl)pentanedioate;utyloxycarbonyl)-4-(cyanom;(2S,4S)-2-tert-butoxycarbonylamino-4-cyanomethyl-pentadioic acid dimethyl ester;HR2002;dimethyl (2S,4R)-2-((tert-butoxycarbonyl)amino)-4-(cyanomethyl)pentanedioate | | CAS: | 328086-57-3 | | MF: | C14H22N2O6 | | MW: | 314.33 | | EINECS: | | | Product Categories: | Amino Acids & Derivatives, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 328086-57-3.mol |  |
| | (4R)-N-(tert-Butyloxycarbonyl)-4-(cyanoMethyl)-L-glutaMic Acid 1,5-DiMethyl Ester Chemical Properties |
| Boiling point | 460.6±45.0 °C(Predicted) | | density | 1.151±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | solubility | Dichloromethane, Ethyl Acetate, Methanol | | form | Oil | | pka | 10.88±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C14H22N2O6/c1-14(2,3)22-13(19)16-10(12(18)21-5)8-9(6-7-15)11(17)20-4/h9-10H,6,8H2,1-5H3,(H,16,19)/t9-,10-/m0/s1 | | InChIKey | QVTOOWHELURIDU-UWVGGRQHSA-N | | SMILES | C(OC)(=O)[C@H](C[C@H](CC#N)C(OC)=O)NC(OC(C)(C)C)=O |
| | (4R)-N-(tert-Butyloxycarbonyl)-4-(cyanoMethyl)-L-glutaMic Acid 1,5-DiMethyl Ester Usage And Synthesis |
| Uses | (4R)-N-(tert-Butyloxycarbonyl)-4-(cyanoMethyl)-L-glutaMic Acid 1,5-DiMethyl Ester is the l-Glutamic Acid (G596960) derivative,used in the preparation of protease inhibitors. |
| | (4R)-N-(tert-Butyloxycarbonyl)-4-(cyanoMethyl)-L-glutaMic Acid 1,5-DiMethyl Ester Preparation Products And Raw materials |
|