|
|
| | 3-bromo-1H-pyrrole-2,5-dione Basic information |
| Product Name: | 3-bromo-1H-pyrrole-2,5-dione | | Synonyms: | 2-Bromomaleimide 98+%;3-Bromo-1H-pyrrole-2,5-dione, 3-Bromo-2,5-dihydro-2,5-dioxo-1H-pyrrole;3-Bromo-1H-pyrrole-2,5-dione;2-Bromomaleimide 95+%;2-Bromomaleimide;1H-Pyrrole-2,5-dione, 3-bromo-;3-bromopyrrole-2,5-dione;3-Bromo-1H-pyrrole-2,5-dione C4H2BrNO2 | | CAS: | 98026-79-0 | | MF: | C4H2BrNO2 | | MW: | 175.97 | | EINECS: | | | Product Categories: | | | Mol File: | 98026-79-0.mol |  |
| | 3-bromo-1H-pyrrole-2,5-dione Chemical Properties |
| Melting point | 153-154 °C | | Boiling point | 267.6±33.0 °C(Predicted) | | density | 2+-.0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | solid | | pka | 6.61±0.40(Predicted) | | color | Light orange | | InChI | InChI=1S/C4H2BrNO2/c5-2-1-3(7)6-4(2)8/h1H,(H,6,7,8) | | InChIKey | QBLRHWLVSHLMSP-UHFFFAOYSA-N | | SMILES | N1C(=O)C=C(Br)C1=O |
| | 3-bromo-1H-pyrrole-2,5-dione Usage And Synthesis |
| Uses | 3-Bromo-1H-pyrrole-2,5-dione (compound 2c) is a 3-substituted pyrrole-2,5-dione compound with antibacterial activity. 3-Bromo-1H-pyrrole-2,5-dione inhibits pathogenic strains of S. aureus ATCC 25923, E. coli ATCC 25922, P. aeruginosa ATCC 27853, with MIC values of 32 μg/mL, 32 μg/mL, and 64 μg/mL, respectively[1]. | | References | [1] Eric Lattmann, et al. Antibacterial Activity of 3-Substituted Pyrrole-2,5-diones Against Pseudomonas Aeruginosa. Letters in Drug Design & Discovery, 2007, 4(7), 513-519. |
| | 3-bromo-1H-pyrrole-2,5-dione Preparation Products And Raw materials |
|